C10H13NO6S2 — CID 106099827
4-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 106099827) has the molecular formula C10H13NO6S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106099827 |
| Molecular Formula | C10H13NO6S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC2(O)CCOC2)cs1 |
| InChI | InChI=1S/C10H13NO6S2/c12-9(13)8-3-7(4-18-8)19(15,16)11-5-10(14)1-2-17-6-10/h3-4,11,14H,1-2,5-6H2,(H,12,13) |
| InChIKey | GIVBIBUMHZEAES-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |