C15H22BrNO3 — CID 103897497
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methyloxan-3-amine (PubChem CID 103897497) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methyloxan-3-amine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methyloxan-3-amine |
|---|---|
| PubChem CID | 103897497 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methyloxan-3-amine |
| SMILES | COc1cc(Br)c(CNC2(C)CCCOC2)cc1OC |
| InChI | InChI=1S/C15H22BrNO3/c1-15(5-4-6-20-10-15)17-9-11-7-13(18-2)14(19-3)8-12(11)16/h7-8,17H,4-6,9-10H2,1-3H3 |
| InChIKey | RHSCXPUUGPGJEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |