C13H27NO2 — CID 103899355
2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)butanamide (PubChem CID 103899355) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)butanamide.
| Compound Name | 2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)butanamide |
|---|---|
| PubChem CID | 103899355 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)butanamide |
| SMILES | CCC(CC)C(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C13H27NO2/c1-5-11(6-2)12(16)14-10-13(3,4)8-7-9-15/h11,15H,5-10H2,1-4H3,(H,14,16) |
| InChIKey | OAMGGUHWFFRJQD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |