C10H18F3NO2 — CID 103899402
3,3,3-trifluoro-N-(5-hydroxy-2,2-dimethylpentyl)propanamide (PubChem CID 103899402) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(5-hydroxy-2,2-dimethylpentyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(5-hydroxy-2,2-dimethylpentyl)propanamide |
|---|---|
| PubChem CID | 103899402 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3,3,3-trifluoro-N-(5-hydroxy-2,2-dimethylpentyl)propanamide |
| SMILES | CC(C)(CCCO)CNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-9(2,4-3-5-15)7-14-8(16)6-10(11,12)13/h15H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | VJKUUTXCZJUYBX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |