C21H46F3NO2 — CID 145149403
ethane;N-(2-methylhexyl)acetamide;(2R)-2-methyl-2-(trifluoromethyl)hexan-1-ol (PubChem CID 145149403) has the molecular formula C21H46F3NO2 and a molecular weight of 401.60 g/mol. Its IUPAC name is ethane;N-(2-methylhexyl)acetamide;(2R)-2-methyl-2-(trifluoromethyl)hexan-1-ol.
| Compound Name | ethane;N-(2-methylhexyl)acetamide;(2R)-2-methyl-2-(trifluoromethyl)hexan-1-ol |
|---|---|
| PubChem CID | 145149403 |
| Molecular Formula | C21H46F3NO2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | ethane;N-(2-methylhexyl)acetamide;(2R)-2-methyl-2-(trifluoromethyl)hexan-1-ol |
| SMILES | CC.CC.CCCCC(C)CNC(C)=O.CCCC[C@](C)(CO)C(F)(F)F |
| InChI | InChI=1S/C9H19NO.C8H15F3O.2C2H6/c1-4-5-6-8(2)7-10-9(3)11;1-3-4-5-7(2,6-12)8(9,10)11;2*1-2/h8H,4-7H2,1-3H3,(H,10,11);12H,3-6H2,1-2H3;2*1-2H3/t;7-;;/m.1../s1 |
| InChIKey | UDFSOKSYQLAXIC-YGPBBXEFSA-N |
| XLogP | 6.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |