C10H17F4NO2 — CID 103820625
2,2,3,3-tetrafluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide (PubChem CID 103820625) has the molecular formula C10H17F4NO2 and a molecular weight of 259.24 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide |
|---|---|
| PubChem CID | 103820625 |
| Molecular Formula | C10H17F4NO2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(2-hydroxyethyl)pentyl]propanamide |
| SMILES | CCCC(CCO)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H17F4NO2/c1-2-3-7(4-5-16)6-15-9(17)10(13,14)8(11)12/h7-8,16H,2-6H2,1H3,(H,15,17) |
| InChIKey | RWVZQZXEZBOUMB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|