C13H23NO2 — CID 103899902
N-(5-hydroxy-2,2-dimethylpentyl)hexa-2,4-dienamide (PubChem CID 103899902) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)hexa-2,4-dienamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 103899902 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C13H23NO2/c1-4-5-6-8-12(16)14-11-13(2,3)9-7-10-15/h4-6,8,15H,7,9-11H2,1-3H3,(H,14,16) |
| InChIKey | SDRSOQFCKUDABW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|