C16H24N2 — CID 103902346
N-pent-4-en-2-yl-1-phenylpiperidin-4-amine (PubChem CID 103902346) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-pent-4-en-2-yl-1-phenylpiperidin-4-amine.
| Compound Name | N-pent-4-en-2-yl-1-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 103902346 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-pent-4-en-2-yl-1-phenylpiperidin-4-amine |
| SMILES | C=CCC(C)NC1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2/c1-3-7-14(2)17-15-10-12-18(13-11-15)16-8-5-4-6-9-16/h3-6,8-9,14-15,17H,1,7,10-13H2,2H3 |
| InChIKey | OHKSQCGRHOUHOC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|