C21H25N3 — CID 124514875
(4S)-4-phenyl-4-[(1-phenylpiperidin-4-yl)amino]butanenitrile (PubChem CID 124514875) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (4S)-4-phenyl-4-[(1-phenylpiperidin-4-yl)amino]butanenitrile.
| Compound Name | (4S)-4-phenyl-4-[(1-phenylpiperidin-4-yl)amino]butanenitrile |
|---|---|
| PubChem CID | 124514875 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (4S)-4-phenyl-4-[(1-phenylpiperidin-4-yl)amino]butanenitrile |
| SMILES | N#CCC[C@H](NC1CCN(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3/c22-15-7-12-21(18-8-3-1-4-9-18)23-19-13-16-24(17-14-19)20-10-5-2-6-11-20/h1-6,8-11,19,21,23H,7,12-14,16-17H2/t21-/m0/s1 |
| InChIKey | BNLGXXZDVSNCKT-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |