C16H21F2NOS — CID 103902504
4-[4-(difluoromethoxy)phenyl]-N-(2-prop-2-ynylsulfanylethyl)butan-2-amine (PubChem CID 103902504) has the molecular formula C16H21F2NOS and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-N-(2-prop-2-ynylsulfanylethyl)butan-2-amine.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-N-(2-prop-2-ynylsulfanylethyl)butan-2-amine |
|---|---|
| PubChem CID | 103902504 |
| Molecular Formula | C16H21F2NOS |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-N-(2-prop-2-ynylsulfanylethyl)butan-2-amine |
| SMILES | C#CCSCCNC(C)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H21F2NOS/c1-3-11-21-12-10-19-13(2)4-5-14-6-8-15(9-7-14)20-16(17)18/h1,6-9,13,16,19H,4-5,10-12H2,2H3 |
| InChIKey | TXUKBWBJTKIJQM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|