C12H17FN2O2 — CID 103904763
3-[[1-(5-fluoro-3-pyridinyl)ethylamino]methyl]oxolan-3-ol (PubChem CID 103904763) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-[[1-(5-fluoro-3-pyridinyl)ethylamino]methyl]oxolan-3-ol.
| Compound Name | 3-[[1-(5-fluoro-3-pyridinyl)ethylamino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 103904763 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-[[1-(5-fluoro-3-pyridinyl)ethylamino]methyl]oxolan-3-ol |
| SMILES | CC(NCC1(O)CCOC1)c1cncc(F)c1 |
| InChI | InChI=1S/C12H17FN2O2/c1-9(10-4-11(13)6-14-5-10)15-7-12(16)2-3-17-8-12/h4-6,9,15-16H,2-3,7-8H2,1H3 |
| InChIKey | IIHMDAMWVHBHBZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |