C10H16N2O2S — CID 115896432
3-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]oxolan-3-ol (PubChem CID 115896432) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]oxolan-3-ol.
| Compound Name | 3-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 115896432 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-[[1-(1,3-thiazol-4-yl)ethylamino]methyl]oxolan-3-ol |
| SMILES | CC(NCC1(O)CCOC1)c1cscn1 |
| InChI | InChI=1S/C10H16N2O2S/c1-8(9-4-15-7-12-9)11-5-10(13)2-3-14-6-10/h4,7-8,11,13H,2-3,5-6H2,1H3 |
| InChIKey | ZGNDNEAIXUBIGF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |