C11H20F3NO — CID 103906287
2,6-dimethyl-N-(4,4,4-trifluorobutan-2-yl)oxan-4-amine (PubChem CID 103906287) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 2,6-dimethyl-N-(4,4,4-trifluorobutan-2-yl)oxan-4-amine.
| Compound Name | 2,6-dimethyl-N-(4,4,4-trifluorobutan-2-yl)oxan-4-amine |
|---|---|
| PubChem CID | 103906287 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2,6-dimethyl-N-(4,4,4-trifluorobutan-2-yl)oxan-4-amine |
| SMILES | CC(CC(F)(F)F)NC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H20F3NO/c1-7(6-11(12,13)14)15-10-4-8(2)16-9(3)5-10/h7-10,15H,4-6H2,1-3H3 |
| InChIKey | SEGJFWYYQKSLTK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |