C15H30N4 — CID 103907121
N-[(1-methyl-1,2,4-triazol-3-yl)methyl]undecan-6-amine (PubChem CID 103907121) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is N-[(1-methyl-1,2,4-triazol-3-yl)methyl]undecan-6-amine.
| Compound Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]undecan-6-amine |
|---|---|
| PubChem CID | 103907121 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]undecan-6-amine |
| SMILES | CCCCCC(CCCCC)NCc1ncn(C)n1 |
| InChI | InChI=1S/C15H30N4/c1-4-6-8-10-14(11-9-7-5-2)16-12-15-17-13-19(3)18-15/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | MVBIDVXEXXQMSQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|