C10H20N4 — CID 115897313
N-[(1-methyl-1,2,4-triazol-3-yl)methyl]hexan-2-amine (PubChem CID 115897313) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N-[(1-methyl-1,2,4-triazol-3-yl)methyl]hexan-2-amine.
| Compound Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]hexan-2-amine |
|---|---|
| PubChem CID | 115897313 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-[(1-methyl-1,2,4-triazol-3-yl)methyl]hexan-2-amine |
| SMILES | CCCCC(C)NCc1ncn(C)n1 |
| InChI | InChI=1S/C10H20N4/c1-4-5-6-9(2)11-7-10-12-8-14(3)13-10/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | GAPZEEBNSUPXKR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |