C16H31N3 — CID 83086754
N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]heptan-2-amine (PubChem CID 83086754) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]heptan-2-amine.
| Compound Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]heptan-2-amine |
|---|---|
| PubChem CID | 83086754 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCc1cn(C)nc1C(C)(C)C |
| InChI | InChI=1S/C16H31N3/c1-7-8-9-10-13(2)17-11-14-12-19(6)18-15(14)16(3,4)5/h12-13,17H,7-11H2,1-6H3 |
| InChIKey | AJBFIKZMZAOXBA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|