C13H25N3 — CID 115895160
N-[2-(1,3-dimethylpyrazol-4-yl)ethyl]hexan-2-amine (PubChem CID 115895160) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[2-(1,3-dimethylpyrazol-4-yl)ethyl]hexan-2-amine.
| Compound Name | N-[2-(1,3-dimethylpyrazol-4-yl)ethyl]hexan-2-amine |
|---|---|
| PubChem CID | 115895160 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-[2-(1,3-dimethylpyrazol-4-yl)ethyl]hexan-2-amine |
| SMILES | CCCCC(C)NCCc1cn(C)nc1C |
| InChI | InChI=1S/C13H25N3/c1-5-6-7-11(2)14-9-8-13-10-16(4)15-12(13)3/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | OASKTCOFQRNPRR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |