C12H23N3 — CID 83094527
4-(1,3-dimethylpyrazol-4-yl)-N-propylbutan-2-amine (PubChem CID 83094527) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-N-propylbutan-2-amine.
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 83094527 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-N-propylbutan-2-amine |
| SMILES | CCCNC(C)CCc1cn(C)nc1C |
| InChI | InChI=1S/C12H23N3/c1-5-8-13-10(2)6-7-12-9-15(4)14-11(12)3/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | ISCQSJXPAIJILH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |