C13H25N3O — CID 65197276
N-(2-butoxyethyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine (PubChem CID 65197276) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is N-(2-butoxyethyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine.
| Compound Name | N-(2-butoxyethyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 65197276 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-(2-butoxyethyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine |
| SMILES | CCCCOCCNC(C)c1cn(C)nc1C |
| InChI | InChI=1S/C13H25N3O/c1-5-6-8-17-9-7-14-11(2)13-10-16(4)15-12(13)3/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | SNZYXGSFZTYQQV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|