C11H21N3O — CID 106841146
4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]butan-1-ol (PubChem CID 106841146) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]butan-1-ol.
| Compound Name | 4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 106841146 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]butan-1-ol |
| SMILES | Cc1nn(C)cc1C(C)NCCCCO |
| InChI | InChI=1S/C11H21N3O/c1-9(12-6-4-5-7-15)11-8-14(3)13-10(11)2/h8-9,12,15H,4-7H2,1-3H3 |
| InChIKey | KOXBAEBKBWXVLS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|