About N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine (PubChem CID 82941029) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine.
Molecular Properties
| Compound Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine |
| PubChem CID | 82941029 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine |
| SMILES | CCCOCCCNC(C)c1cn(C)nc1C |
| InChI | InChI=1S/C13H25N3O/c1-5-8-17-9-6-7-14-11(2)13-10-16(4)15-12(13)3/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | UMVMVJNZMQXAEI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine?
The IUPAC name of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine (CID 82941029) is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine.
What is the SMILES notation for N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine?
The canonical SMILES for N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine is CCCOCCCNC(C)c1cn(C)nc1C.
What is the InChIKey of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine?
The InChIKey is UMVMVJNZMQXAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-5-8-17-9-6-7-14-11(2)13-10-16(4)15-12(13)3/h10-11,14H,5-9H2,1-4H3.
What are the key properties of N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine?
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine has a molecular weight of 239.36 g/mol, XLogP of 2.20, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-propoxypropan-1-amine is sourced from PubChem (CID 82941029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).