C12H8BrF3N2O2S — CID 103907836
N-(6-bromo-2-methyl-3-pyridinyl)-2,4,6-trifluorobenzenesulfonamide (PubChem CID 103907836) has the molecular formula C12H8BrF3N2O2S and a molecular weight of 381.17 g/mol. Its IUPAC name is N-(6-bromo-2-methyl-3-pyridinyl)-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(6-bromo-2-methyl-3-pyridinyl)-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103907836 |
| Molecular Formula | C12H8BrF3N2O2S |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | N-(6-bromo-2-methyl-3-pyridinyl)-2,4,6-trifluorobenzenesulfonamide |
| SMILES | Cc1nc(Br)ccc1NS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H8BrF3N2O2S/c1-6-10(2-3-11(13)17-6)18-21(19,20)12-8(15)4-7(14)5-9(12)16/h2-5,18H,1H3 |
| InChIKey | DGJVVSLGJIVNQN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|