About N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide
N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide (PubChem CID 103908093) has the molecular formula C16H12Br2N2O
and a molecular weight of 408.09 g/mol. Its IUPAC name is N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide.
Molecular Properties
| Compound Name | N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide |
| PubChem CID | 103908093 |
| Molecular Formula | C16H12Br2N2O |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide |
| SMILES | N#CCN(Cc1ccccc1)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C16H12Br2N2O/c17-14-8-13(9-15(18)10-14)16(21)20(7-6-19)11-12-4-2-1-3-5-12/h1-5,8-10H,7,11H2 |
| InChIKey | ZJKXLJKHHHEGEP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide?
The IUPAC name of N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide (CID 103908093) is N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide.
What is the SMILES notation for N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide?
The canonical SMILES for N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide is N#CCN(Cc1ccccc1)C(=O)c1cc(Br)cc(Br)c1.
What is the InChIKey of N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide?
The InChIKey is ZJKXLJKHHHEGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Br2N2O/c17-14-8-13(9-15(18)10-14)16(21)20(7-6-19)11-12-4-2-1-3-5-12/h1-5,8-10H,7,11H2.
What are the key properties of N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide?
N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide has a molecular weight of 408.09 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3,5-dibromo-N-(cyanomethyl)benzamide is sourced from PubChem (CID 103908093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).