C22H24N2O — CID 52688629
N-benzyl-N-(cyanomethyl)-4-cyclohexylbenzamide (PubChem CID 52688629) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is N-benzyl-N-(cyanomethyl)-4-cyclohexylbenzamide.
| Compound Name | N-benzyl-N-(cyanomethyl)-4-cyclohexylbenzamide |
|---|---|
| PubChem CID | 52688629 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | N-benzyl-N-(cyanomethyl)-4-cyclohexylbenzamide |
| SMILES | N#CCN(Cc1ccccc1)C(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H24N2O/c23-15-16-24(17-18-7-3-1-4-8-18)22(25)21-13-11-20(12-14-21)19-9-5-2-6-10-19/h1,3-4,7-8,11-14,19H,2,5-6,9-10,16-17H2 |
| InChIKey | OMNVCGNGXUOEJG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|