C11H13Br2NO2 — CID 103908515
3,5-dibromo-N-(2-methylpropoxy)benzamide (PubChem CID 103908515) has the molecular formula C11H13Br2NO2 and a molecular weight of 351.04 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-methylpropoxy)benzamide.
| Compound Name | 3,5-dibromo-N-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 103908515 |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | 3,5-dibromo-N-(2-methylpropoxy)benzamide |
| SMILES | CC(C)CONC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H13Br2NO2/c1-7(2)6-16-14-11(15)8-3-9(12)5-10(13)4-8/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | FKHPMPWMJKWFAZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|