C14H17Br2N3O2 — CID 103908954
2-[4-(3,5-dibromobenzoyl)piperazin-1-yl]-N-methylacetamide (PubChem CID 103908954) has the molecular formula C14H17Br2N3O2 and a molecular weight of 419.12 g/mol. Its IUPAC name is 2-[4-(3,5-dibromobenzoyl)piperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-(3,5-dibromobenzoyl)piperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 103908954 |
| Molecular Formula | C14H17Br2N3O2 |
| Molecular Weight | 419.12 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 2-[4-(3,5-dibromobenzoyl)piperazin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCN(C(=O)c2cc(Br)cc(Br)c2)CC1 |
| InChI | InChI=1S/C14H17Br2N3O2/c1-17-13(20)9-18-2-4-19(5-3-18)14(21)10-6-11(15)8-12(16)7-10/h6-8H,2-5,9H2,1H3,(H,17,20) |
| InChIKey | PKIAWOIPEBSOBX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.12 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |