C14H11Br2NO2 — CID 103909337
3,5-dibromo-N-[(2-hydroxyphenyl)methyl]benzamide (PubChem CID 103909337) has the molecular formula C14H11Br2NO2 and a molecular weight of 385.06 g/mol. Its IUPAC name is 3,5-dibromo-N-[(2-hydroxyphenyl)methyl]benzamide.
| Compound Name | 3,5-dibromo-N-[(2-hydroxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 103909337 |
| Molecular Formula | C14H11Br2NO2 |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 3,5-dibromo-N-[(2-hydroxyphenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H11Br2NO2/c15-11-5-10(6-12(16)7-11)14(19)17-8-9-3-1-2-4-13(9)18/h1-7,18H,8H2,(H,17,19) |
| InChIKey | ADZRTTHIFHGKRT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|