C14H14BrN3O — CID 61401694
3,5-diamino-N-[(2-bromophenyl)methyl]benzamide (PubChem CID 61401694) has the molecular formula C14H14BrN3O and a molecular weight of 320.19 g/mol. Its IUPAC name is 3,5-diamino-N-[(2-bromophenyl)methyl]benzamide.
| Compound Name | 3,5-diamino-N-[(2-bromophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 61401694 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 3,5-diamino-N-[(2-bromophenyl)methyl]benzamide |
| SMILES | Nc1cc(N)cc(C(=O)NCc2ccccc2Br)c1 |
| InChI | InChI=1S/C14H14BrN3O/c15-13-4-2-1-3-9(13)8-18-14(19)10-5-11(16)7-12(17)6-10/h1-7H,8,16-17H2,(H,18,19) |
| InChIKey | QOBUQPYZVHCPDR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|