C15H23N3O2 — CID 103911495
5-[1-[(5-hydroxy-4-methylpentyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 103911495) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-[1-[(5-hydroxy-4-methylpentyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-[(5-hydroxy-4-methylpentyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103911495 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 5-[1-[(5-hydroxy-4-methylpentyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC(CO)CCCNC(C)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H23N3O2/c1-10(9-19)4-3-7-16-11(2)12-5-6-13-14(8-12)18-15(20)17-13/h5-6,8,10-11,16,19H,3-4,7,9H2,1-2H3,(H2,17,18,20) |
| InChIKey | PQUMMNRSBDGENA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|