C13H19Cl2NO — CID 103911833
3-[(3,4-dichlorophenyl)methylamino]-2,3-dimethylbutan-2-ol (PubChem CID 103911833) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylamino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(3,4-dichlorophenyl)methylamino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 103911833 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylamino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO/c1-12(2,13(3,4)17)16-8-9-5-6-10(14)11(15)7-9/h5-7,16-17H,8H2,1-4H3 |
| InChIKey | ILBLMEVLWLOTEI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |