C17H21FN2O — CID 103912390
3-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-2-fluorobenzonitrile (PubChem CID 103912390) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-2-fluorobenzonitrile.
| Compound Name | 3-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103912390 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cccc(CN2CCC3(O)CCCCC3C2)c1F |
| InChI | InChI=1S/C17H21FN2O/c18-16-13(10-19)4-3-5-14(16)11-20-9-8-17(21)7-2-1-6-15(17)12-20/h3-5,15,21H,1-2,6-9,11-12H2 |
| InChIKey | JLAKJKKUSKFYQX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |