C17H21FN2O — CID 81108061
2-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-5-fluorobenzonitrile (PubChem CID 81108061) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-5-fluorobenzonitrile.
| Compound Name | 2-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 81108061 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)methyl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1CN1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C17H21FN2O/c18-16-5-4-13(14(9-16)10-19)11-20-8-7-17(21)6-2-1-3-15(17)12-20/h4-5,9,15,21H,1-3,6-8,11-12H2 |
| InChIKey | CSBYQQIJICZNLC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |