C17H16ClFN2 — CID 103913061
5-[[1-(3-chlorophenyl)propylamino]methyl]-2-fluorobenzonitrile (PubChem CID 103913061) has the molecular formula C17H16ClFN2 and a molecular weight of 302.78 g/mol. Its IUPAC name is 5-[[1-(3-chlorophenyl)propylamino]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[1-(3-chlorophenyl)propylamino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103913061 |
| Molecular Formula | C17H16ClFN2 |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-[[1-(3-chlorophenyl)propylamino]methyl]-2-fluorobenzonitrile |
| SMILES | CCC(NCc1ccc(F)c(C#N)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClFN2/c1-2-17(13-4-3-5-15(18)9-13)21-11-12-6-7-16(19)14(8-12)10-20/h3-9,17,21H,2,11H2,1H3 |
| InChIKey | PPTKFDMBCCGSCZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |