C9H12F3N3O4 — CID 103915495
2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 103915495) has the molecular formula C9H12F3N3O4 and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 103915495 |
| Molecular Formula | C9H12F3N3O4 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O4/c10-9(11,12)5-14(1-2-16)7(18)4-15-6(17)3-13-8(15)19/h16H,1-5H2,(H,13,19) |
| InChIKey | SCBJSPLYBYNRQJ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|