C12H19N3O4 — CID 54994361
N-cyclopentyl-2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 54994361) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-cyclopentyl-2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 54994361 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-cyclopentyl-2-(2,5-dioxoimidazolidin-1-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C1CNC(=O)N1CC(=O)N(CCO)C1CCCC1 |
| InChI | InChI=1S/C12H19N3O4/c16-6-5-14(9-3-1-2-4-9)11(18)8-15-10(17)7-13-12(15)19/h9,16H,1-8H2,(H,13,19) |
| InChIKey | FIVUKNWRSKNRKP-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|