C8H14N2O2S — CID 103919822
2-(cyanomethylsulfanyl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide (PubChem CID 103919822) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 103919822 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[(2R)-1-hydroxybutan-2-yl]acetamide |
| SMILES | CC[C@H](CO)NC(=O)CSCC#N |
| InChI | InChI=1S/C8H14N2O2S/c1-2-7(5-11)10-8(12)6-13-4-3-9/h7,11H,2,4-6H2,1H3,(H,10,12)/t7-/m1/s1 |
| InChIKey | USJKDEOUSOFHQA-SSDOTTSWSA-N |
| XLogP | 0.13 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|