C9H19NO3S — CID 43427721
N-(1-hydroxybutan-2-yl)-2-(2-methoxyethylsulfanyl)acetamide (PubChem CID 43427721) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)-2-(2-methoxyethylsulfanyl)acetamide.
| Compound Name | N-(1-hydroxybutan-2-yl)-2-(2-methoxyethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 43427721 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)-2-(2-methoxyethylsulfanyl)acetamide |
| SMILES | CCC(CO)NC(=O)CSCCOC |
| InChI | InChI=1S/C9H19NO3S/c1-3-8(6-11)10-9(12)7-14-5-4-13-2/h8,11H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | WORLTDKQQJMQJP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|