C10H17NO6S — CID 63307466
(2S)-4-methoxy-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 63307466) has the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. Its IUPAC name is (2S)-4-methoxy-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-methoxy-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307466 |
| Molecular Formula | C10H17NO6S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (2S)-4-methoxy-2-[[2-(2-methoxyethylsulfanyl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | COCCSCC(=O)N[C@@H](CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C10H17NO6S/c1-16-3-4-18-6-8(12)11-7(10(14)15)5-9(13)17-2/h7H,3-6H2,1-2H3,(H,11,12)(H,14,15)/t7-/m0/s1 |
| InChIKey | VGYILJMTDXMZSE-ZETCQYMHSA-N |
| XLogP | -0.50 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|