C11H19NO5S — CID 55205180
(2S)-2-[(2-butylsulfanylacetyl)amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 55205180) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is (2S)-2-[(2-butylsulfanylacetyl)amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(2-butylsulfanylacetyl)amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 55205180 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2S)-2-[(2-butylsulfanylacetyl)amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | CCCCSCC(=O)N[C@@H](CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C11H19NO5S/c1-3-4-5-18-7-9(13)12-8(11(15)16)6-10(14)17-2/h8H,3-7H2,1-2H3,(H,12,13)(H,15,16)/t8-/m0/s1 |
| InChIKey | XXJIZASNHGCWMP-QMMMGPOBSA-N |
| XLogP | 0.65 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|