C14H10F2N2O2S — CID 103920662
N-(2-cyano-3-methylphenyl)-2,4-difluorobenzenesulfonamide (PubChem CID 103920662) has the molecular formula C14H10F2N2O2S and a molecular weight of 308.31 g/mol. Its IUPAC name is N-(2-cyano-3-methylphenyl)-2,4-difluorobenzenesulfonamide.
| Compound Name | N-(2-cyano-3-methylphenyl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103920662 |
| Molecular Formula | C14H10F2N2O2S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N-(2-cyano-3-methylphenyl)-2,4-difluorobenzenesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(F)cc2F)c1C#N |
| InChI | InChI=1S/C14H10F2N2O2S/c1-9-3-2-4-13(11(9)8-17)18-21(19,20)14-6-5-10(15)7-12(14)16/h2-7,18H,1H3 |
| InChIKey | UADGCPNVPHYKAL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |