C9H17F2NO2 — CID 103921698
3-[(3-ethoxycyclobutyl)amino]-1,1-difluoropropan-2-ol (PubChem CID 103921698) has the molecular formula C9H17F2NO2 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-[(3-ethoxycyclobutyl)amino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(3-ethoxycyclobutyl)amino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103921698 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-[(3-ethoxycyclobutyl)amino]-1,1-difluoropropan-2-ol |
| SMILES | CCOC1CC(NCC(O)C(F)F)C1 |
| InChI | InChI=1S/C9H17F2NO2/c1-2-14-7-3-6(4-7)12-5-8(13)9(10)11/h6-9,12-13H,2-5H2,1H3 |
| InChIKey | OWAMNECMDZEQSG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |