C13H27NO2 — CID 103921424
1-[(3-ethoxycyclobutyl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 103921424) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-[(3-ethoxycyclobutyl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(3-ethoxycyclobutyl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 103921424 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-[(3-ethoxycyclobutyl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | CCOC1CC(NCC(O)CC(C)(C)C)C1 |
| InChI | InChI=1S/C13H27NO2/c1-5-16-12-6-10(7-12)14-9-11(15)8-13(2,3)4/h10-12,14-15H,5-9H2,1-4H3 |
| InChIKey | ADUKKIGPDOCTQW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |