C12H26N2O — CID 107151493
1-[(3-aminocyclopentyl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 107151493) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-[(3-aminocyclopentyl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(3-aminocyclopentyl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107151493 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-[(3-aminocyclopentyl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNC1CCC(N)C1 |
| InChI | InChI=1S/C12H26N2O/c1-12(2,3)7-11(15)8-14-10-5-4-9(13)6-10/h9-11,14-15H,4-8,13H2,1-3H3 |
| InChIKey | TVLUHDQDIXREOM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |