C15H23ClN2O — CID 103929186
(2R)-2-amino-N-[1-(4-chlorophenyl)ethyl]-N,3,3-trimethylbutanamide (PubChem CID 103929186) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-(4-chlorophenyl)ethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2R)-2-amino-N-[1-(4-chlorophenyl)ethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 103929186 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2R)-2-amino-N-[1-(4-chlorophenyl)ethyl]-N,3,3-trimethylbutanamide |
| SMILES | CC(c1ccc(Cl)cc1)N(C)C(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H23ClN2O/c1-10(11-6-8-12(16)9-7-11)18(5)14(19)13(17)15(2,3)4/h6-10,13H,17H2,1-5H3/t10?,13-/m0/s1 |
| InChIKey | VNGOJPOQWZAUTH-HQVZTVAUSA-N |
| XLogP | 3.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |