C14H23N3O — CID 61163259
(2S)-2-amino-N,3,3-trimethyl-N-(1-pyridin-4-ylethyl)butanamide (PubChem CID 61163259) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (2S)-2-amino-N,3,3-trimethyl-N-(1-pyridin-4-ylethyl)butanamide.
| Compound Name | (2S)-2-amino-N,3,3-trimethyl-N-(1-pyridin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 61163259 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (2S)-2-amino-N,3,3-trimethyl-N-(1-pyridin-4-ylethyl)butanamide |
| SMILES | CC(c1ccncc1)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C14H23N3O/c1-10(11-6-8-16-9-7-11)17(5)13(18)12(15)14(2,3)4/h6-10,12H,15H2,1-5H3/t10?,12-/m1/s1 |
| InChIKey | IZGUNXQJNLEGCW-TVKKRMFBSA-N |
| XLogP | 1.97 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |