C13H21N3O3S — CID 60962966
2-amino-N-methyl-4-methylsulfonyl-N-(1-pyridin-4-ylethyl)butanamide (PubChem CID 60962966) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-amino-N-methyl-4-methylsulfonyl-N-(1-pyridin-4-ylethyl)butanamide.
| Compound Name | 2-amino-N-methyl-4-methylsulfonyl-N-(1-pyridin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 60962966 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-amino-N-methyl-4-methylsulfonyl-N-(1-pyridin-4-ylethyl)butanamide |
| SMILES | CC(c1ccncc1)N(C)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H21N3O3S/c1-10(11-4-7-15-8-5-11)16(2)13(17)12(14)6-9-20(3,18)19/h4-5,7-8,10,12H,6,9,14H2,1-3H3 |
| InChIKey | XKQXXDBASWXKRH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |