C12H28N2O3S — CID 103931281
2-(dipropylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane (PubChem CID 103931281) has the molecular formula C12H28N2O3S and a molecular weight of 280.43 g/mol. Its IUPAC name is 2-(dipropylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane.
| Compound Name | 2-(dipropylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane |
|---|---|
| PubChem CID | 103931281 |
| Molecular Formula | C12H28N2O3S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-(dipropylsulfamoylamino)-3-hydroxy-2,3-dimethylbutane |
| SMILES | CCCN(CCC)S(=O)(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C12H28N2O3S/c1-7-9-14(10-8-2)18(16,17)13-11(3,4)12(5,6)15/h13,15H,7-10H2,1-6H3 |
| InChIKey | YGOSBZHZYSSXPK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |