C15H16N2O — CID 103932297
N-(3,4-dihydro-2H-chromen-4-yl)-5-methylpyridin-3-amine (PubChem CID 103932297) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-5-methylpyridin-3-amine.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 103932297 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-5-methylpyridin-3-amine |
| SMILES | Cc1cncc(NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C15H16N2O/c1-11-8-12(10-16-9-11)17-14-6-7-18-15-5-3-2-4-13(14)15/h2-5,8-10,14,17H,6-7H2,1H3 |
| InChIKey | ARZPWQDMDISKJT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |