C16H33NO2 — CID 103933708
2-[(4-tert-butylcycloheptyl)amino]-2-ethylpropane-1,3-diol (PubChem CID 103933708) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 2-[(4-tert-butylcycloheptyl)amino]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[(4-tert-butylcycloheptyl)amino]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 103933708 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 2-[(4-tert-butylcycloheptyl)amino]-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NC1CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33NO2/c1-5-16(11-18,12-19)17-14-8-6-7-13(9-10-14)15(2,3)4/h13-14,17-19H,5-12H2,1-4H3 |
| InChIKey | YOQDQVAEYYDJSQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |