C29H38INO4 — CID 10393632
(1S,2S,6R,14R,15S,16R)-5-(cyclopropylmethyl)-16-[2-[(E)-3-iodoprop-2-enoxy]propan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol (PubChem CID 10393632) has the molecular formula C29H38INO4 and a molecular weight of 591.53 g/mol. Its IUPAC name is (1S,2S,6R,14R,15S,16R)-5-(cyclopropylmethyl)-16-[2-[(E)-3-iodoprop-2-enoxy]propan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol.
| Compound Name | (1S,2S,6R,14R,15S,16R)-5-(cyclopropylmethyl)-16-[2-[(E)-3-iodoprop-2-enoxy]propan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
|---|---|
| PubChem CID | 10393632 |
| Molecular Formula | C29H38INO4 |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | (1S,2S,6R,14R,15S,16R)-5-(cyclopropylmethyl)-16-[2-[(E)-3-iodoprop-2-enoxy]propan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
| SMILES | CO[C@@]12CC[C@@]3(C[C@@H]1C(C)(C)OC/C=C/I)[C@H]1Cc4ccc(O)c5c4[C@@]3(CCN1CC1CC1)[C@H]2O5 |
| InChI | InChI=1S/C29H38INO4/c1-26(2,34-14-4-12-30)21-16-27-9-10-29(21,33-3)25-28(27)11-13-31(17-18-5-6-18)22(27)15-19-7-8-20(32)24(35-25)23(19)28/h4,7-8,12,18,21-22,25,32H,5-6,9-11,13-17H2,1-3H3/b12-4+/t21-,22-,25-,27-,28+,29+/m1/s1 |
| InChIKey | XKDHFDPDYDYJRA-YXXJESGKSA-N |
| XLogP | 5.36 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|